C60H54 — CID 140873499
4-[3-[3-[9-[3-(3,5-ditert-butylphenyl)phenyl]fluoren-9-yl]phenyl]phenyl]-9,9-dimethylfluorene (PubChem CID 140873499) has the molecular formula C60H54 and a molecular weight of 775.09 g/mol. Its IUPAC name is 4-[3-[3-[9-[3-(3,5-ditert-butylphenyl)phenyl]fluoren-9-yl]phenyl]phenyl]-9,9-dimethylfluorene.
| Compound Name | 4-[3-[3-[9-[3-(3,5-ditert-butylphenyl)phenyl]fluoren-9-yl]phenyl]phenyl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 140873499 |
| Molecular Formula | C60H54 |
| Molecular Weight | 775.09 g/mol |
| Exact Mass | 774.42 |
| IUPAC Name | 4-[3-[3-[9-[3-(3,5-ditert-butylphenyl)phenyl]fluoren-9-yl]phenyl]phenyl]-9,9-dimethylfluorene |
| SMILES | CC(C)(C)c1cc(-c2cccc(C3(c4cccc(-c5cccc(-c6cccc7c6-c6ccccc6C7(C)C)c5)c4)c4ccccc4-c4ccccc43)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C60H54/c1-57(2,3)46-36-43(37-47(38-46)58(4,5)6)41-21-17-24-45(35-41)60(53-30-13-9-25-49(53)50-26-10-14-31-54(50)60)44-23-16-20-40(34-44)39-19-15-22-42(33-39)48-28-18-32-55-56(48)51-27-11-12-29-52(51)59(55,7)8/h9-38H,1-8H3 |
| InChIKey | PEOHYZIBEQNVQO-UHFFFAOYSA-N |
| XLogP | 15.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.09 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |