C59H38N4 — CID 162775952
2-(3,5-diphenylphenyl)-4-[4-(6-isocyano-9,9-diphenylfluoren-2-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 162775952) has the molecular formula C59H38N4 and a molecular weight of 802.98 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-[4-(6-isocyano-9,9-diphenylfluoren-2-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-[4-(6-isocyano-9,9-diphenylfluoren-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 162775952 |
| Molecular Formula | C59H38N4 |
| Molecular Weight | 802.98 g/mol |
| Exact Mass | 802.31 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-[4-(6-isocyano-9,9-diphenylfluoren-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)n4)cc3)cc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C59H38N4/c1-60-51-32-34-54-53(39-51)52-33-31-45(38-55(52)59(54,49-23-13-5-14-24-49)50-25-15-6-16-26-50)42-27-29-44(30-28-42)57-61-56(43-21-11-4-12-22-43)62-58(63-57)48-36-46(40-17-7-2-8-18-40)35-47(37-48)41-19-9-3-10-20-41/h2-39H |
| InChIKey | DUKDPHLGXDBIAZ-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.98 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|