C66H43N3 — CID 162776284
4-[3-[3-(7-isocyano-9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2,6-bis(4-phenylphenyl)pyrimidine (PubChem CID 162776284) has the molecular formula C66H43N3 and a molecular weight of 878.09 g/mol. Its IUPAC name is 4-[3-[3-(7-isocyano-9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2,6-bis(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[3-[3-(7-isocyano-9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2,6-bis(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 162776284 |
| Molecular Formula | C66H43N3 |
| Molecular Weight | 878.09 g/mol |
| Exact Mass | 877.35 |
| IUPAC Name | 4-[3-[3-(7-isocyano-9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2,6-bis(4-phenylphenyl)pyrimidine |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1ccc(-c3cccc(-c4cccc(-c5cc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccc(-c7ccccc7)cc6)n5)c4)c3)cc1-2 |
| InChI | InChI=1S/C66H43N3/c1-67-58-37-38-59-60-42-54(36-39-61(60)66(62(59)43-58,56-24-10-4-11-25-56)57-26-12-5-13-27-57)52-21-14-20-51(40-52)53-22-15-23-55(41-53)64-44-63(49-32-28-47(29-33-49)45-16-6-2-7-17-45)68-65(69-64)50-34-30-48(31-35-50)46-18-8-3-9-19-46/h2-44H |
| InChIKey | MVDGVOJMFASFPV-UHFFFAOYSA-N |
| XLogP | 17.06 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.09 |
| LogP ≤ 5 | 17.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|