C56H33N3 — CID 162775891
4-[4-(7-isocyano-9,9'-spirobi[fluorene]-3-yl)phenyl]-2,6-dinaphthalen-2-ylpyrimidine (PubChem CID 162775891) has the molecular formula C56H33N3 and a molecular weight of 747.90 g/mol. Its IUPAC name is 4-[4-(7-isocyano-9,9'-spirobi[fluorene]-3-yl)phenyl]-2,6-dinaphthalen-2-ylpyrimidine.
| Compound Name | 4-[4-(7-isocyano-9,9'-spirobi[fluorene]-3-yl)phenyl]-2,6-dinaphthalen-2-ylpyrimidine |
|---|---|
| PubChem CID | 162775891 |
| Molecular Formula | C56H33N3 |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 747.27 |
| IUPAC Name | 4-[4-(7-isocyano-9,9'-spirobi[fluorene]-3-yl)phenyl]-2,6-dinaphthalen-2-ylpyrimidine |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccc(-c3ccc(-c4cc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)cc3)cc1-2 |
| InChI | InChI=1S/C56H33N3/c1-57-44-27-28-47-48-32-41(26-29-51(48)56(52(47)33-44)49-16-8-6-14-45(49)46-15-7-9-17-50(46)56)37-18-22-38(23-19-37)53-34-54(42-24-20-35-10-2-4-12-39(35)30-42)59-55(58-53)43-25-21-36-11-3-5-13-40(36)31-43/h2-34H |
| InChIKey | YUHASOGFBLGCPP-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|