C53H32N4 — CID 162776400
2-[4-(6-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 162776400) has the molecular formula C53H32N4 and a molecular weight of 724.87 g/mol. Its IUPAC name is 2-[4-(6-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-(6-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 162776400 |
| Molecular Formula | C53H32N4 |
| Molecular Weight | 724.87 g/mol |
| Exact Mass | 724.26 |
| IUPAC Name | 2-[4-(6-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc3)cc1C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C53H32N4/c1-54-41-29-31-48-45(33-41)44-30-28-40(32-49(44)53(48)46-18-10-8-16-42(46)43-17-9-11-19-47(43)53)36-22-26-39(27-23-36)52-56-50(37-14-6-3-7-15-37)55-51(57-52)38-24-20-35(21-25-38)34-12-4-2-5-13-34/h2-33H |
| InChIKey | NSXYIDWHMKLPBU-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.87 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|