C63H38N4 — CID 158025405
2-[4-[3-[4-(4-isocyanophenyl)phenyl]spiro[benzo[a]phenalene-7,9'-fluorene]-9-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 158025405) has the molecular formula C63H38N4 and a molecular weight of 851.02 g/mol. Its IUPAC name is 2-[4-[3-[4-(4-isocyanophenyl)phenyl]spiro[benzo[a]phenalene-7,9'-fluorene]-9-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[3-[4-(4-isocyanophenyl)phenyl]spiro[benzo[a]phenalene-7,9'-fluorene]-9-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 158025405 |
| Molecular Formula | C63H38N4 |
| Molecular Weight | 851.02 g/mol |
| Exact Mass | 850.31 |
| IUPAC Name | 2-[4-[3-[4-(4-isocyanophenyl)phenyl]spiro[benzo[a]phenalene-7,9'-fluorene]-9-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3ccc4c5c(cccc35)C3(c5ccccc5-c5ccccc53)c3cc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C63H38N4/c1-64-48-34-31-41(32-35-48)40-23-27-43(28-24-40)49-37-38-54-52-36-33-47(39-58(52)63(57-22-12-19-53(49)59(54)57)55-20-10-8-17-50(55)51-18-9-11-21-56(51)63)42-25-29-46(30-26-42)62-66-60(44-13-4-2-5-14-44)65-61(67-62)45-15-6-3-7-16-45/h2-39H |
| InChIKey | FGNXANWQUUHXSY-UHFFFAOYSA-N |
| XLogP | 15.92 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.02 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|