C59H34N4S — CID 159190958
2-(8-isocyanodibenzothiophen-3-yl)-4-phenyl-6-[3-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 159190958) has the molecular formula C59H34N4S and a molecular weight of 831.02 g/mol. Its IUPAC name is 2-(8-isocyanodibenzothiophen-3-yl)-4-phenyl-6-[3-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-(8-isocyanodibenzothiophen-3-yl)-4-phenyl-6-[3-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 159190958 |
| Molecular Formula | C59H34N4S |
| Molecular Weight | 831.02 g/mol |
| Exact Mass | 830.25 |
| IUPAC Name | 2-(8-isocyanodibenzothiophen-3-yl)-4-phenyl-6-[3-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2sc3cc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccc(-c7ccc8c(c7)C7(c9ccccc9-c9ccccc97)c7ccccc7-8)cc6)c5)n4)ccc3c2c1 |
| InChI | InChI=1S/C59H34N4S/c1-60-43-28-31-54-49(35-43)48-30-27-42(34-55(48)64-54)58-62-56(38-12-3-2-4-13-38)61-57(63-58)41-15-11-14-39(32-41)36-22-24-37(25-23-36)40-26-29-47-46-18-7-10-21-52(46)59(53(47)33-40)50-19-8-5-16-44(50)45-17-6-9-20-51(45)59/h2-35H |
| InChIKey | FZUCKBYCZHRQJA-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.02 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|