C53H34N4 — CID 162776070
2-[3-(6-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine (PubChem CID 162776070) has the molecular formula C53H34N4 and a molecular weight of 726.88 g/mol. Its IUPAC name is 2-[3-(6-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(6-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 162776070 |
| Molecular Formula | C53H34N4 |
| Molecular Weight | 726.88 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | 2-[3-(6-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5-c5ccccc5)n4)c3)ccc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H34N4/c1-54-43-30-32-49-47(35-43)46-34-39(29-31-48(46)53(49,41-23-10-4-11-24-41)42-25-12-5-13-26-42)38-21-16-22-40(33-38)51-55-50(37-19-8-3-9-20-37)56-52(57-51)45-28-15-14-27-44(45)36-17-6-2-7-18-36/h2-35H |
| InChIKey | BSYHKQKSHSFAPO-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.88 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|