C38H50 — CID 170942414
6-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 170942414) has the molecular formula C38H50 and a molecular weight of 506.82 g/mol. Its IUPAC name is 6-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 170942414 |
| Molecular Formula | C38H50 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.39 |
| IUPAC Name | 6-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)C(C)(C)CCC3(C)C)cc(-c2ccc3c(c2)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C38H50/c1-34(2,3)29-21-27(25-12-14-30-32(23-25)37(8,9)18-16-35(30,4)5)20-28(22-29)26-13-15-31-33(24-26)38(10,11)19-17-36(31,6)7/h12-15,20-24H,16-19H2,1-11H3 |
| InChIKey | ZZFCGYTXQRDRLV-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |