C27H36 — CID 169030071
3-tert-butyl-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene (PubChem CID 169030071) has the molecular formula C27H36 and a molecular weight of 360.59 g/mol. Its IUPAC name is 3-tert-butyl-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene.
| Compound Name | 3-tert-butyl-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene |
|---|---|
| PubChem CID | 169030071 |
| Molecular Formula | C27H36 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 3-tert-butyl-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc3c(cc1C2(C)C)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C27H36/c1-24(2,3)17-10-11-20-18(14-17)19-15-22-23(16-21(19)27(20,8)9)26(6,7)13-12-25(22,4)5/h10-11,14-16H,12-13H2,1-9H3 |
| InChIKey | BYSCCFGBOZZIMD-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |