C51H53N — CID 170445450
N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenyl-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]fluoren-2-amine (PubChem CID 170445450) has the molecular formula C51H53N and a molecular weight of 679.99 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenyl-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]fluoren-2-amine.
| Compound Name | N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenyl-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 170445450 |
| Molecular Formula | C51H53N |
| Molecular Weight | 679.99 g/mol |
| Exact Mass | 679.42 |
| IUPAC Name | N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenyl-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]fluoren-2-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccccc2)c2cc3c(cc2-c2ccc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)cc2)-c2ccccc2C3(C)C)cc1 |
| InChI | InChI=1S/C51H53N/c1-48(2,3)37-24-26-39(27-25-37)52(38-15-11-10-12-16-38)47-33-45-42(40-17-13-14-18-43(40)51(45,8)9)32-41(47)35-21-19-34(20-22-35)36-23-28-44-46(31-36)50(6,7)30-29-49(44,4)5/h10-28,31-33H,29-30H2,1-9H3 |
| InChIKey | GMLKXPSQIKKUEF-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.99 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |