C61H63N — CID 170445740
9,9-dimethyl-N-phenyl-N,3-bis[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)phenyl]fluoren-2-amine (PubChem CID 170445740) has the molecular formula C61H63N and a molecular weight of 810.18 g/mol. Its IUPAC name is 9,9-dimethyl-N-phenyl-N,3-bis[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-phenyl-N,3-bis[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 170445740 |
| Molecular Formula | C61H63N |
| Molecular Weight | 810.18 g/mol |
| Exact Mass | 809.50 |
| IUPAC Name | 9,9-dimethyl-N-phenyl-N,3-bis[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)phenyl]fluoren-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2c(-c3ccc(-c4cc5c(cc4N(c4ccccc4)c4ccc(-c6cccc7c6C(C)(C)CCC7(C)C)cc4)C(C)(C)c4ccccc4-5)cc3)cccc21 |
| InChI | InChI=1S/C61H63N/c1-57(2)34-36-59(5,6)55-45(21-16-24-51(55)57)40-26-28-42(29-27-40)48-38-49-47-20-14-15-23-50(47)61(9,10)53(49)39-54(48)62(43-18-12-11-13-19-43)44-32-30-41(31-33-44)46-22-17-25-52-56(46)60(7,8)37-35-58(52,3)4/h11-33,38-39H,34-37H2,1-10H3 |
| InChIKey | AIUBWXNYLPUKKW-UHFFFAOYSA-N |
| XLogP | 17.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.18 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |