C41H41N — CID 170445023
9,9-dimethyl-N,N-diphenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine (PubChem CID 170445023) has the molecular formula C41H41N and a molecular weight of 547.79 g/mol. Its IUPAC name is 9,9-dimethyl-N,N-diphenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N,N-diphenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 170445023 |
| Molecular Formula | C41H41N |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | 9,9-dimethyl-N,N-diphenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc4c(cc3N(c3ccccc3)c3ccccc3)C(C)(C)c3ccccc3-4)ccc21 |
| InChI | InChI=1S/C41H41N/c1-39(2)23-24-40(3,4)37-25-28(21-22-35(37)39)32-26-33-31-19-13-14-20-34(31)41(5,6)36(33)27-38(32)42(29-15-9-7-10-16-29)30-17-11-8-12-18-30/h7-22,25-27H,23-24H2,1-6H3 |
| InChIKey | ASYCCMZPKXVSDP-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |