C52H61N — CID 170446406
9,9-dimethyl-N-phenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-N-(5,5,8,8-tetramethyl-2-propan-2-yl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine (PubChem CID 170446406) has the molecular formula C52H61N and a molecular weight of 700.07 g/mol. Its IUPAC name is 9,9-dimethyl-N-phenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-N-(5,5,8,8-tetramethyl-2-propan-2-yl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-phenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-N-(5,5,8,8-tetramethyl-2-propan-2-yl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 170446406 |
| Molecular Formula | C52H61N |
| Molecular Weight | 700.07 g/mol |
| Exact Mass | 699.48 |
| IUPAC Name | 9,9-dimethyl-N-phenyl-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-N-(5,5,8,8-tetramethyl-2-propan-2-yl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine |
| SMILES | CC(C)c1ccc2c(c1N(c1ccccc1)c1cc3c(cc1-c1ccc4c(c1)C(C)(C)CCC4(C)C)-c1ccccc1C3(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C52H61N/c1-33(2)36-23-25-42-46(51(9,10)29-28-49(42,5)6)47(36)53(35-18-14-13-15-19-35)45-32-43-39(37-20-16-17-21-40(37)52(43,11)12)31-38(45)34-22-24-41-44(30-34)50(7,8)27-26-48(41,3)4/h13-25,30-33H,26-29H2,1-12H3 |
| InChIKey | BZFXTJOKNIXIOQ-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.07 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |