C58H63N — CID 170446175
N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine (PubChem CID 170446175) has the molecular formula C58H63N and a molecular weight of 774.15 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 170446175 |
| Molecular Formula | C58H63N |
| Molecular Weight | 774.15 g/mol |
| Exact Mass | 773.50 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc4c(cc3N(c3ccc5c(c3)C(C)(C)c3ccccc3-5)c3cccc5c3C(C)(C)CCC5(C)C)C(C)(C)c3ccccc3-4)ccc21 |
| InChI | InChI=1S/C58H63N/c1-53(2)28-29-55(5,6)49-32-36(24-27-45(49)53)41-34-42-39-19-14-16-21-44(39)58(11,12)48(42)35-51(41)59(50-23-17-22-46-52(50)56(7,8)31-30-54(46,3)4)37-25-26-40-38-18-13-15-20-43(38)57(9,10)47(40)33-37/h13-27,32-35H,28-31H2,1-12H3 |
| InChIKey | LYVXJGGNMSNENJ-UHFFFAOYSA-N |
| XLogP | 16.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.15 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |