C67H71N — CID 170449512
N,N,3'-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-9,9'-spirobi[fluorene]-2'-amine (PubChem CID 170449512) has the molecular formula C67H71N and a molecular weight of 890.31 g/mol. Its IUPAC name is N,N,3'-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-9,9'-spirobi[fluorene]-2'-amine.
| Compound Name | N,N,3'-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-9,9'-spirobi[fluorene]-2'-amine |
|---|---|
| PubChem CID | 170449512 |
| Molecular Formula | C67H71N |
| Molecular Weight | 890.31 g/mol |
| Exact Mass | 889.56 |
| IUPAC Name | N,N,3'-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-9,9'-spirobi[fluorene]-2'-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc4c(cc3N(c3ccc5c(c3)C(C)(C)CCC5(C)C)c3ccc5c(c3)C(C)(C)CCC5(C)C)C3(c5ccccc5-c5ccccc53)c3ccccc3-4)ccc21 |
| InChI | InChI=1S/C67H71N/c1-61(2)31-34-64(7,8)57-37-42(25-28-53(57)61)48-40-49-47-21-15-18-24-52(47)67(50-22-16-13-19-45(50)46-20-14-17-23-51(46)67)56(49)41-60(48)68(43-26-29-54-58(38-43)65(9,10)35-32-62(54,3)4)44-27-30-55-59(39-44)66(11,12)36-33-63(55,5)6/h13-30,37-41H,31-36H2,1-12H3 |
| InChIKey | HEKUZJKJPVNQPH-UHFFFAOYSA-N |
| XLogP | 18.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.31 |
| LogP ≤ 5 | 18.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |