C57H63N — CID 174288374
9,9-dimethyl-N,N-bis(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-3-(4-phenylphenyl)fluoren-2-amine (PubChem CID 174288374) has the molecular formula C57H63N and a molecular weight of 762.14 g/mol. Its IUPAC name is 9,9-dimethyl-N,N-bis(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-3-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N,N-bis(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-3-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 174288374 |
| Molecular Formula | C57H63N |
| Molecular Weight | 762.14 g/mol |
| Exact Mass | 761.50 |
| IUPAC Name | 9,9-dimethyl-N,N-bis(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-3-(4-phenylphenyl)fluoren-2-amine |
| SMILES | Cc1ccc2c(c1N(c1cc3c(cc1-c1ccc(-c4ccccc4)cc1)-c1ccccc1C3(C)C)c1c(C)ccc3c1C(C)(C)CCC3(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C57H63N/c1-36-22-28-45-49(55(7,8)32-30-53(45,3)4)51(36)58(52-37(2)23-29-46-50(52)56(9,10)33-31-54(46,5)6)48-35-47-43(41-20-16-17-21-44(41)57(47,11)12)34-42(48)40-26-24-39(25-27-40)38-18-14-13-15-19-38/h13-29,34-35H,30-33H2,1-12H3 |
| InChIKey | LPLRYQQGJVFTBS-UHFFFAOYSA-N |
| XLogP | 16.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.14 |
| LogP ≤ 5 | 16.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |