C50H59N — CID 170446597
N,N-bis(4-tert-butylphenyl)-9,9-dimethyl-3-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine (PubChem CID 170446597) has the molecular formula C50H59N and a molecular weight of 674.03 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-9,9-dimethyl-3-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-9,9-dimethyl-3-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 170446597 |
| Molecular Formula | C50H59N |
| Molecular Weight | 674.03 g/mol |
| Exact Mass | 673.46 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-9,9-dimethyl-3-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)fluoren-2-amine |
| SMILES | Cc1ccc2c(c1-c1cc3c(cc1N(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1)C(C)(C)c1ccccc1-3)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C50H59N/c1-32-18-27-41-45(49(10,11)29-28-48(41,8)9)44(32)39-30-38-37-16-14-15-17-40(37)50(12,13)42(38)31-43(39)51(35-23-19-33(20-24-35)46(2,3)4)36-25-21-34(22-26-36)47(5,6)7/h14-27,30-31H,28-29H2,1-13H3 |
| InChIKey | JORNMGFMURUMBT-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.03 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |