C36H39N — CID 174287822
9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-N-phenylfluoren-2-amine (PubChem CID 174287822) has the molecular formula C36H39N and a molecular weight of 485.72 g/mol. Its IUPAC name is 9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-N-phenylfluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-N-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 174287822 |
| Molecular Formula | C36H39N |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | 9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-N-phenylfluoren-2-amine |
| SMILES | Cc1cc2c(cc1N(c1ccccc1)c1ccc3c(c1)C(C)(C)c1ccccc1-3)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C36H39N/c1-24-21-31-32(35(4,5)20-19-34(31,2)3)23-33(24)37(25-13-9-8-10-14-25)26-17-18-28-27-15-11-12-16-29(27)36(6,7)30(28)22-26/h8-18,21-23H,19-20H2,1-7H3 |
| InChIKey | MDQQBVJNVWLCHP-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |