C46H49N — CID 170446758
9,9-dimethyl-3-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-N-phenyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine (PubChem CID 170446758) has the molecular formula C46H49N and a molecular weight of 615.91 g/mol. Its IUPAC name is 9,9-dimethyl-3-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-N-phenyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-3-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-N-phenyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 170446758 |
| Molecular Formula | C46H49N |
| Molecular Weight | 615.91 g/mol |
| Exact Mass | 615.39 |
| IUPAC Name | 9,9-dimethyl-3-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-N-phenyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
| SMILES | Cc1cc2c(cc1-c1cc3c(cc1N(c1ccccc1)c1ccc4c(c1)C(C)(C)CCC4(C)C)C(C)(C)c1ccccc1-3)CCCC2 |
| InChI | InChI=1S/C46H49N/c1-30-25-31-15-11-12-16-32(31)26-36(30)38-28-37-35-19-13-14-20-39(35)46(6,7)41(37)29-43(38)47(33-17-9-8-10-18-33)34-21-22-40-42(27-34)45(4,5)24-23-44(40,2)3/h8-10,13-14,17-22,25-29H,11-12,15-16,23-24H2,1-7H3 |
| InChIKey | DKNIYPOODRZAGT-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.91 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |