C53H61N — CID 170446367
9,9-dimethyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine (PubChem CID 170446367) has the molecular formula C53H61N and a molecular weight of 712.08 g/mol. Its IUPAC name is 9,9-dimethyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 170446367 |
| Molecular Formula | C53H61N |
| Molecular Weight | 712.08 g/mol |
| Exact Mass | 711.48 |
| IUPAC Name | 9,9-dimethyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(N(c3ccc4c(c3)C(C)(C)CCC4(C)C)c3cc4c(cc3-c3cccc5c3CCCC5)-c3ccccc3C4(C)C)ccc21 |
| InChI | InChI=1S/C53H61N/c1-49(2)26-28-51(5,6)46-30-35(22-24-43(46)49)54(36-23-25-44-47(31-36)52(7,8)29-27-50(44,3)4)48-33-45-40(39-19-13-14-21-42(39)53(45,9)10)32-41(48)38-20-15-17-34-16-11-12-18-37(34)38/h13-15,17,19-25,30-33H,11-12,16,18,26-29H2,1-10H3 |
| InChIKey | WJMVPHFKNHKKIW-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.08 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |