C42H40ClNO — CID 167133329
2-chloro-N-(9,9-dimethylfluoren-2-yl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-4-amine (PubChem CID 167133329) has the molecular formula C42H40ClNO and a molecular weight of 610.24 g/mol. Its IUPAC name is 2-chloro-N-(9,9-dimethylfluoren-2-yl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-4-amine.
| Compound Name | 2-chloro-N-(9,9-dimethylfluoren-2-yl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 167133329 |
| Molecular Formula | C42H40ClNO |
| Molecular Weight | 610.24 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | 2-chloro-N-(9,9-dimethylfluoren-2-yl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-4-amine |
| SMILES | Cc1cc2c(cc1N(c1ccc3c(c1)C(C)(C)c1ccccc1-3)c1cc(Cl)cc3c1oc1ccccc13)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C42H40ClNO/c1-25-20-34-35(41(4,5)19-18-40(34,2)3)24-36(25)44(37-22-26(43)21-31-30-13-9-11-15-38(30)45-39(31)37)27-16-17-29-28-12-8-10-14-32(28)42(6,7)33(29)23-27/h8-17,20-24H,18-19H2,1-7H3 |
| InChIKey | HRIYSPXPISYJIH-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.24 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |