C60H61N — CID 170449198
N,N-bis(4-tert-butylphenyl)-3'-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-9,9'-spirobi[fluorene]-2'-amine (PubChem CID 170449198) has the molecular formula C60H61N and a molecular weight of 796.15 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-3'-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-9,9'-spirobi[fluorene]-2'-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-3'-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-9,9'-spirobi[fluorene]-2'-amine |
|---|---|
| PubChem CID | 170449198 |
| Molecular Formula | C60H61N |
| Molecular Weight | 796.15 g/mol |
| Exact Mass | 795.48 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-3'-(2,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)-9,9'-spirobi[fluorene]-2'-amine |
| SMILES | Cc1ccc2c(c1-c1cc3c(cc1N(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1)C1(c4ccccc4-c4ccccc41)c1ccccc1-3)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C60H61N/c1-38-24-33-51-55(59(10,11)35-34-58(51,8)9)54(38)47-36-46-45-20-14-17-23-50(45)60(48-21-15-12-18-43(48)44-19-13-16-22-49(44)60)52(46)37-53(47)61(41-29-25-39(26-30-41)56(2,3)4)42-31-27-40(28-32-42)57(5,6)7/h12-33,36-37H,34-35H2,1-11H3 |
| InChIKey | BDMDXPVWQSBTQT-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.15 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |