C54H72 — CID 159255668
5,5,8,8,12,12,16,16,19,19-decamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaene;2,7-ditert-butyl-9,9-dimethylfluorene (PubChem CID 159255668) has the molecular formula C54H72 and a molecular weight of 721.17 g/mol. Its IUPAC name is 5,5,8,8,12,12,16,16,19,19-decamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaene;2,7-ditert-butyl-9,9-dimethylfluorene.
| Compound Name | 5,5,8,8,12,12,16,16,19,19-decamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaene;2,7-ditert-butyl-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 159255668 |
| Molecular Formula | C54H72 |
| Molecular Weight | 721.17 g/mol |
| Exact Mass | 720.56 |
| IUPAC Name | 5,5,8,8,12,12,16,16,19,19-decamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaene;2,7-ditert-butyl-9,9-dimethylfluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)ccc1-2.CC1(C)CCC(C)(C)c2cc3c(cc21)-c1cc2c(cc1C3(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C31H42.C23H30/c1-27(2)11-13-29(5,6)25-17-21-19(15-23(25)27)20-16-24-26(18-22(20)31(21,9)10)30(7,8)14-12-28(24,3)4;1-21(2,3)15-9-11-17-18-12-10-16(22(4,5)6)14-20(18)23(7,8)19(17)13-15/h15-18H,11-14H2,1-10H3;9-14H,1-8H3 |
| InChIKey | KVWBRGNAUDKHIP-UHFFFAOYSA-N |
| XLogP | 15.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.17 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |