C25H34 — CID 143017257
9,9-dimethyl-2,7-bis(2-methylbutan-2-yl)fluorene (PubChem CID 143017257) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is 9,9-dimethyl-2,7-bis(2-methylbutan-2-yl)fluorene.
| Compound Name | 9,9-dimethyl-2,7-bis(2-methylbutan-2-yl)fluorene |
|---|---|
| PubChem CID | 143017257 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 9,9-dimethyl-2,7-bis(2-methylbutan-2-yl)fluorene |
| SMILES | CCC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)CC)ccc1-2 |
| InChI | InChI=1S/C25H34/c1-9-23(3,4)17-11-13-19-20-14-12-18(24(5,6)10-2)16-22(20)25(7,8)21(19)15-17/h11-16H,9-10H2,1-8H3 |
| InChIKey | CCAVPSYLDOEJER-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |