C22H27Br — CID 90463480
2-(1-bromoethyl)-9,9-dimethyl-7-(2-methylbutan-2-yl)fluorene (PubChem CID 90463480) has the molecular formula C22H27Br and a molecular weight of 371.36 g/mol. Its IUPAC name is 2-(1-bromoethyl)-9,9-dimethyl-7-(2-methylbutan-2-yl)fluorene.
| Compound Name | 2-(1-bromoethyl)-9,9-dimethyl-7-(2-methylbutan-2-yl)fluorene |
|---|---|
| PubChem CID | 90463480 |
| Molecular Formula | C22H27Br |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-(1-bromoethyl)-9,9-dimethyl-7-(2-methylbutan-2-yl)fluorene |
| SMILES | CCC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)Br)ccc1-2 |
| InChI | InChI=1S/C22H27Br/c1-7-21(3,4)16-9-11-18-17-10-8-15(14(2)23)12-19(17)22(5,6)20(18)13-16/h8-14H,7H2,1-6H3 |
| InChIKey | JLJYRURCDRMJQP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|