C18H19Br3 — CID 107980960
1,3-dibromo-5-[bromo-[4-(2-methylbutan-2-yl)phenyl]methyl]benzene (PubChem CID 107980960) has the molecular formula C18H19Br3 and a molecular weight of 475.06 g/mol. Its IUPAC name is 1,3-dibromo-5-[bromo-[4-(2-methylbutan-2-yl)phenyl]methyl]benzene.
| Compound Name | 1,3-dibromo-5-[bromo-[4-(2-methylbutan-2-yl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 107980960 |
| Molecular Formula | C18H19Br3 |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 471.90 |
| IUPAC Name | 1,3-dibromo-5-[bromo-[4-(2-methylbutan-2-yl)phenyl]methyl]benzene |
| SMILES | CCC(C)(C)c1ccc(C(Br)c2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C18H19Br3/c1-4-18(2,3)14-7-5-12(6-8-14)17(21)13-9-15(19)11-16(20)10-13/h5-11,17H,4H2,1-3H3 |
| InChIKey | CYLIDLVACRPIGU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|