C16H19BrOS — CID 107964313
(5-bromothiophen-3-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol (PubChem CID 107964313) has the molecular formula C16H19BrOS and a molecular weight of 339.30 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol.
| Compound Name | (5-bromothiophen-3-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 107964313 |
| Molecular Formula | C16H19BrOS |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (5-bromothiophen-3-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
| SMILES | CCC(C)(C)c1ccc(C(O)c2csc(Br)c2)cc1 |
| InChI | InChI=1S/C16H19BrOS/c1-4-16(2,3)13-7-5-11(6-8-13)15(18)12-9-14(17)19-10-12/h5-10,15,18H,4H2,1-3H3 |
| InChIKey | DGHRAYASYMTMQW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |