C16H19BrO2 — CID 66260156
(5-bromofuran-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol (PubChem CID 66260156) has the molecular formula C16H19BrO2 and a molecular weight of 323.23 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol.
| Compound Name | (5-bromofuran-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 66260156 |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (5-bromofuran-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
| SMILES | CCC(C)(C)c1ccc(C(O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C16H19BrO2/c1-4-16(2,3)12-7-5-11(6-8-12)15(18)13-9-10-14(17)19-13/h5-10,15,18H,4H2,1-3H3 |
| InChIKey | QSHFHIKDADXFOA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |