C19H23ClO — CID 81316592
(3-chloro-5-methylphenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol (PubChem CID 81316592) has the molecular formula C19H23ClO and a molecular weight of 302.85 g/mol. Its IUPAC name is (3-chloro-5-methylphenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol.
| Compound Name | (3-chloro-5-methylphenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 81316592 |
| Molecular Formula | C19H23ClO |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (3-chloro-5-methylphenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
| SMILES | CCC(C)(C)c1ccc(C(O)c2cc(C)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H23ClO/c1-5-19(3,4)16-8-6-14(7-9-16)18(21)15-10-13(2)11-17(20)12-15/h6-12,18,21H,5H2,1-4H3 |
| InChIKey | XSYJIXKTMGSISW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |