C17H21ClOS — CID 103404428
(3-chloro-4-methylthiophen-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol (PubChem CID 103404428) has the molecular formula C17H21ClOS and a molecular weight of 308.87 g/mol. Its IUPAC name is (3-chloro-4-methylthiophen-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol.
| Compound Name | (3-chloro-4-methylthiophen-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 103404428 |
| Molecular Formula | C17H21ClOS |
| Molecular Weight | 308.87 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (3-chloro-4-methylthiophen-2-yl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
| SMILES | CCC(C)(C)c1ccc(C(O)c2scc(C)c2Cl)cc1 |
| InChI | InChI=1S/C17H21ClOS/c1-5-17(3,4)13-8-6-12(7-9-13)15(19)16-14(18)11(2)10-20-16/h6-10,15,19H,5H2,1-4H3 |
| InChIKey | RSYYFLJPXOUWTR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |