C18H20BrFO — CID 66257836
(2-bromo-4-fluorophenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol (PubChem CID 66257836) has the molecular formula C18H20BrFO and a molecular weight of 351.26 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol.
| Compound Name | (2-bromo-4-fluorophenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 66257836 |
| Molecular Formula | C18H20BrFO |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-[4-(2-methylbutan-2-yl)phenyl]methanol |
| SMILES | CCC(C)(C)c1ccc(C(O)c2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C18H20BrFO/c1-4-18(2,3)13-7-5-12(6-8-13)17(21)15-10-9-14(20)11-16(15)19/h5-11,17,21H,4H2,1-3H3 |
| InChIKey | KEZWCNYTWAVZOP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |