C18H19FS — CID 178015976
7-(2-fluoropropan-2-yl)-9,9-dimethylfluorene-2-thiol (PubChem CID 178015976) has the molecular formula C18H19FS and a molecular weight of 286.42 g/mol. Its IUPAC name is 7-(2-fluoropropan-2-yl)-9,9-dimethylfluorene-2-thiol.
| Compound Name | 7-(2-fluoropropan-2-yl)-9,9-dimethylfluorene-2-thiol |
|---|---|
| PubChem CID | 178015976 |
| Molecular Formula | C18H19FS |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 7-(2-fluoropropan-2-yl)-9,9-dimethylfluorene-2-thiol |
| SMILES | CC(C)(F)c1ccc2c(c1)C(C)(C)c1cc(S)ccc1-2 |
| InChI | InChI=1S/C18H19FS/c1-17(2)15-9-11(18(3,4)19)5-7-13(15)14-8-6-12(20)10-16(14)17/h5-10,20H,1-4H3 |
| InChIKey | WAOGEDULOBOCOY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|