C52H56Si — CID 58738500
bis(4-tert-butylphenyl)-bis(7,9,9-trimethylfluoren-2-yl)silane (PubChem CID 58738500) has the molecular formula C52H56Si and a molecular weight of 709.11 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-bis(7,9,9-trimethylfluoren-2-yl)silane.
| Compound Name | bis(4-tert-butylphenyl)-bis(7,9,9-trimethylfluoren-2-yl)silane |
|---|---|
| PubChem CID | 58738500 |
| Molecular Formula | C52H56Si |
| Molecular Weight | 709.11 g/mol |
| Exact Mass | 708.42 |
| IUPAC Name | bis(4-tert-butylphenyl)-bis(7,9,9-trimethylfluoren-2-yl)silane |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc([Si](c3ccc(C(C)(C)C)cc3)(c3ccc(C(C)(C)C)cc3)c3ccc4c(c3)C(C)(C)c3cc(C)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C52H56Si/c1-33-13-25-41-43-27-23-39(31-47(43)51(9,10)45(41)29-33)53(37-19-15-35(16-20-37)49(3,4)5,38-21-17-36(18-22-38)50(6,7)8)40-24-28-44-42-26-14-34(2)30-46(42)52(11,12)48(44)32-40/h13-32H,1-12H3 |
| InChIKey | DPJMBNLVHQQFNC-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.11 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|