C69H56Si — CID 59061597
(4-methylphenyl)-diphenyl-[4-[4-[2-[4-[4-[2-[4-(7,9,9-trimethylfluoren-2-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]phenyl]silane (PubChem CID 59061597) has the molecular formula C69H56Si and a molecular weight of 913.29 g/mol. Its IUPAC name is (4-methylphenyl)-diphenyl-[4-[4-[2-[4-[4-[2-[4-(7,9,9-trimethylfluoren-2-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]phenyl]silane.
| Compound Name | (4-methylphenyl)-diphenyl-[4-[4-[2-[4-[4-[2-[4-(7,9,9-trimethylfluoren-2-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 59061597 |
| Molecular Formula | C69H56Si |
| Molecular Weight | 913.29 g/mol |
| Exact Mass | 912.42 |
| IUPAC Name | (4-methylphenyl)-diphenyl-[4-[4-[2-[4-[4-[2-[4-(7,9,9-trimethylfluoren-2-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]phenyl]silane |
| SMILES | Cc1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(-c3ccc(C=Cc4ccc(-c5ccc(C=Cc6ccc(-c7ccc8c(c7)C(C)(C)c7cc(C)ccc7-8)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C69H56Si/c1-49-15-41-63(42-16-49)70(61-11-7-5-8-12-61,62-13-9-6-10-14-62)64-43-38-58(39-44-64)57-34-26-53(27-35-57)19-18-51-22-30-55(31-23-51)56-32-24-52(25-33-56)20-21-54-28-36-59(37-29-54)60-40-46-66-65-45-17-50(2)47-67(65)69(3,4)68(66)48-60/h5-48H,1-4H3 |
| InChIKey | LMRUATZCUOZTQN-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.29 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|