C37H32N4Si — CID 20582032
(5-methylpyrazin-2-yl)-diphenyl-[5-(7,9,9-trimethylfluoren-2-yl)pyrazin-2-yl]silane (PubChem CID 20582032) has the molecular formula C37H32N4Si and a molecular weight of 560.78 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-diphenyl-[5-(7,9,9-trimethylfluoren-2-yl)pyrazin-2-yl]silane.
| Compound Name | (5-methylpyrazin-2-yl)-diphenyl-[5-(7,9,9-trimethylfluoren-2-yl)pyrazin-2-yl]silane |
|---|---|
| PubChem CID | 20582032 |
| Molecular Formula | C37H32N4Si |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (5-methylpyrazin-2-yl)-diphenyl-[5-(7,9,9-trimethylfluoren-2-yl)pyrazin-2-yl]silane |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-c3cnc([Si](c4ccccc4)(c4ccccc4)c4cnc(C)cn4)cn3)ccc1-2 |
| InChI | InChI=1S/C37H32N4Si/c1-25-15-17-30-31-18-16-27(20-33(31)37(3,4)32(30)19-25)34-22-41-36(24-39-34)42(28-11-7-5-8-12-28,29-13-9-6-10-14-29)35-23-38-26(2)21-40-35/h5-24H,1-4H3 |
| InChIKey | CBBHZFPMNJFVMP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|