C43H34 — CID 59217271
9,9-dimethyl-2,7-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene (PubChem CID 59217271) has the molecular formula C43H34 and a molecular weight of 550.75 g/mol. Its IUPAC name is 9,9-dimethyl-2,7-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene.
| Compound Name | 9,9-dimethyl-2,7-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene |
|---|---|
| PubChem CID | 59217271 |
| Molecular Formula | C43H34 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 9,9-dimethyl-2,7-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene |
| SMILES | CC1(C)c2cc(-c3ccc(/C=C/c4ccccc4)cc3)ccc2-c2ccc(-c3ccc(/C=C/c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C43H34/c1-43(2)41-29-37(35-21-17-33(18-22-35)15-13-31-9-5-3-6-10-31)25-27-39(41)40-28-26-38(30-42(40)43)36-23-19-34(20-24-36)16-14-32-11-7-4-8-12-32/h3-30H,1-2H3/b15-13+,16-14+ |
| InChIKey | YJCGPHAJWIAQDF-WXUKJITCSA-N |
| XLogP | 11.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|