C43H44 — CID 163875744
12,12-bis(4-tert-butylphenyl)-2,6,6-trimethylindeno[1,2-b]fluorene (PubChem CID 163875744) has the molecular formula C43H44 and a molecular weight of 560.83 g/mol. Its IUPAC name is 12,12-bis(4-tert-butylphenyl)-2,6,6-trimethylindeno[1,2-b]fluorene.
| Compound Name | 12,12-bis(4-tert-butylphenyl)-2,6,6-trimethylindeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 163875744 |
| Molecular Formula | C43H44 |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 12,12-bis(4-tert-butylphenyl)-2,6,6-trimethylindeno[1,2-b]fluorene |
| SMILES | Cc1ccc2c(c1)C(c1ccc(C(C)(C)C)cc1)(c1ccc(C(C)(C)C)cc1)c1cc3c(cc1-2)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C43H44/c1-27-14-23-33-35-25-37-34(32-12-10-11-13-36(32)42(37,8)9)26-39(35)43(38(33)24-27,30-19-15-28(16-20-30)40(2,3)4)31-21-17-29(18-22-31)41(5,6)7/h10-26H,1-9H3 |
| InChIKey | PORUFJUSQYSKML-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |