C38H51N — CID 155595906
N-[4-tert-butyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine (PubChem CID 155595906) has the molecular formula C38H51N and a molecular weight of 521.83 g/mol. Its IUPAC name is N-[4-tert-butyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine.
| Compound Name | N-[4-tert-butyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 155595906 |
| Molecular Formula | C38H51N |
| Molecular Weight | 521.83 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | N-[4-tert-butyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
| SMILES | CC(C)(C)c1ccc(Nc2ccc3c(c2)C(C)(C)CCC3(C)C)c(-c2ccc3c(c2)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C38H51N/c1-34(2,3)26-13-17-33(39-27-14-16-30-32(24-27)38(10,11)21-19-36(30,6)7)28(23-26)25-12-15-29-31(22-25)37(8,9)20-18-35(29,4)5/h12-17,22-24,39H,18-21H2,1-11H3 |
| InChIKey | ZQCXFLYHVCFLKC-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.83 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |