C30H37N — CID 164931155
N-[4-tert-butyl-2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine (PubChem CID 164931155) has the molecular formula C30H37N and a molecular weight of 416.66 g/mol. Its IUPAC name is N-[4-tert-butyl-2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine.
| Compound Name | N-[4-tert-butyl-2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 164931155 |
| Molecular Formula | C30H37N |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | N-[4-tert-butyl-2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(C(C)(C)C)ccc2Nc2ccc3c(c2)C(C)(C)CCC3(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C30H37N/c1-28(2,3)22-13-16-27(24(19-22)21-11-9-8-10-12-21)31-23-14-15-25-26(20-23)30(6,7)18-17-29(25,4)5/h8-16,19-20,31H,17-18H2,1-7H3/i8D,9D,10D,11D,12D |
| InChIKey | OOORGTJGJIALDC-AERUFEGBSA-N |
| XLogP | 8.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |