C20H27N2O+ — CID 142949513
hydroxy-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]azanium (PubChem CID 142949513) has the molecular formula C20H27N2O+ and a molecular weight of 311.45 g/mol. Its IUPAC name is hydroxy-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]azanium.
| Compound Name | hydroxy-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]azanium |
|---|---|
| PubChem CID | 142949513 |
| Molecular Formula | C20H27N2O+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | hydroxy-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]azanium |
| SMILES | CC1(C)CCC(C)(C)c2cc(Nc3ccccc3[NH2+]O)ccc21 |
| InChI | InChI=1S/C20H26N2O/c1-19(2)11-12-20(3,4)16-13-14(9-10-15(16)19)21-17-7-5-6-8-18(17)22-23/h5-10,13,21-23H,11-12H2,1-4H3/p+1 |
| InChIKey | NLWGLZLICIAKEC-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|