C30H35N — CID 164550717
9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)fluoren-3-amine (PubChem CID 164550717) has the molecular formula C30H35N and a molecular weight of 409.62 g/mol. Its IUPAC name is 9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)fluoren-3-amine.
| Compound Name | 9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)fluoren-3-amine |
|---|---|
| PubChem CID | 164550717 |
| Molecular Formula | C30H35N |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 9,9-dimethyl-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)fluoren-3-amine |
| SMILES | Cc1cc2c(cc1Nc1ccc3c(c1)-c1ccccc1C3(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H35N/c1-19-16-25-26(29(4,5)15-14-28(25,2)3)18-27(19)31-20-12-13-24-22(17-20)21-10-8-9-11-23(21)30(24,6)7/h8-13,16-18,31H,14-15H2,1-7H3 |
| InChIKey | ICINZWRMVHTEKS-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |