C32H38BNO3 — CID 169083278
N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-3-amine (PubChem CID 169083278) has the molecular formula C32H38BNO3 and a molecular weight of 495.47 g/mol. Its IUPAC name is N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-3-amine.
| Compound Name | N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-3-amine |
|---|---|
| PubChem CID | 169083278 |
| Molecular Formula | C32H38BNO3 |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-3-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(Nc3cc4oc5ccccc5c4cc3B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C32H38BNO3/c1-29(2)15-16-30(3,4)24-17-20(13-14-23(24)29)34-26-19-28-22(21-11-9-10-12-27(21)35-28)18-25(26)33-36-31(5,6)32(7,8)37-33/h9-14,17-19,34H,15-16H2,1-8H3 |
| InChIKey | NEIYOGZMZJVECK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|