About CID 174077741
CID 174077741 (PubChem CID 174077741) has the molecular formula C51H46BN2O
and a molecular weight of 713.75 g/mol.
Molecular Properties
| Compound Name | CID 174077741 |
| PubChem CID | 174077741 |
| Molecular Formula | C51H46BN2O |
| Molecular Weight | 713.75 g/mol |
| Exact Mass | 713.37 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(C)c2cc(Nc3cc4oc5ccccc5c4cc3-c3c4c(cc5ccccc35)N3C5=C(C=CCC5)C(C)(C)c5cccc(c53)[B]4)ccc21 |
| InChI | InChI=1S/C51H46BN2O/c1-49(2)24-25-50(3,4)39-27-31(22-23-36(39)49)53-41-29-45-34(33-16-9-12-21-44(33)55-45)28-35(41)46-32-15-8-7-14-30(32)26-43-47(46)52-40-19-13-18-38-48(40)54(43)42-20-11-10-17-37(42)51(38,5)6/h7-10,12-19,21-23,26-29,53H,11,20,24-25H2,1-6H3 |
| InChIKey | OMPQTSGTIBLYPD-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 713.75 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174077741 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174077741?
The IUPAC name of CID 174077741 (CID 174077741) is not available.
What is the SMILES notation for CID 174077741?
The canonical SMILES for CID 174077741 is CC1(C)CCC(C)(C)c2cc(Nc3cc4oc5ccccc5c4cc3-c3c4c(cc5ccccc35)N3C5=C(C=CCC5)C(C)(C)c5cccc(c53)[B]4)ccc21.
What is the InChIKey of CID 174077741?
The InChIKey is OMPQTSGTIBLYPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C51H46BN2O/c1-49(2)24-25-50(3,4)39-27-31(22-23-36(39)49)53-41-29-45-34(33-16-9-12-21-44(33)55-45)28-35(41)46-32-15-8-7-14-30(32)26-43-47(46)52-40-19-13-18-38-48(40)54(43)42-20-11-10-17-37(42)51(38,5)6/h7-10,12-19,21-23,26-29,53H,11,20,24-25H2,1-6H3.
What are the key properties of CID 174077741?
CID 174077741 has a molecular weight of 713.75 g/mol, XLogP of 12.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174077741 is sourced from PubChem (CID 174077741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).