C26H29N — CID 163300047
5,5,8,8-tetramethyl-N,3-diphenyl-6,7-dihydronaphthalen-2-amine (PubChem CID 163300047) has the molecular formula C26H29N and a molecular weight of 355.53 g/mol. Its IUPAC name is 5,5,8,8-tetramethyl-N,3-diphenyl-6,7-dihydronaphthalen-2-amine.
| Compound Name | 5,5,8,8-tetramethyl-N,3-diphenyl-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 163300047 |
| Molecular Formula | C26H29N |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 5,5,8,8-tetramethyl-N,3-diphenyl-6,7-dihydronaphthalen-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3ccccc3)c(Nc3ccccc3)cc21 |
| InChI | InChI=1S/C26H29N/c1-25(2)15-16-26(3,4)23-18-24(27-20-13-9-6-10-14-20)21(17-22(23)25)19-11-7-5-8-12-19/h5-14,17-18,27H,15-16H2,1-4H3 |
| InChIKey | HMCVPYFKGBGJOO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |