C30H39NS — CID 155595926
5,5,8,8-tetramethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydrobenzo[f][1]benzothiol-3-amine (PubChem CID 155595926) has the molecular formula C30H39NS and a molecular weight of 445.72 g/mol. Its IUPAC name is 5,5,8,8-tetramethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydrobenzo[f][1]benzothiol-3-amine.
| Compound Name | 5,5,8,8-tetramethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydrobenzo[f][1]benzothiol-3-amine |
|---|---|
| PubChem CID | 155595926 |
| Molecular Formula | C30H39NS |
| Molecular Weight | 445.72 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 5,5,8,8-tetramethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydrobenzo[f][1]benzothiol-3-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(Nc3csc4cc5c(cc34)C(C)(C)CCC5(C)C)ccc21 |
| InChI | InChI=1S/C30H39NS/c1-27(2)11-12-28(3,4)22-15-19(9-10-21(22)27)31-25-18-32-26-17-24-23(16-20(25)26)29(5,6)13-14-30(24,7)8/h9-10,15-18,31H,11-14H2,1-8H3 |
| InChIKey | YWHQIJUTLHEJLA-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.72 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |