C23H33NS — CID 174100243
N-[(2S)-3,3-dimethylpent-4-en-2-yl]-5,5,8,8-tetramethyl-6,7-dihydrobenzo[f][1]benzothiol-3-amine (PubChem CID 174100243) has the molecular formula C23H33NS and a molecular weight of 355.59 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethylpent-4-en-2-yl]-5,5,8,8-tetramethyl-6,7-dihydrobenzo[f][1]benzothiol-3-amine.
| Compound Name | N-[(2S)-3,3-dimethylpent-4-en-2-yl]-5,5,8,8-tetramethyl-6,7-dihydrobenzo[f][1]benzothiol-3-amine |
|---|---|
| PubChem CID | 174100243 |
| Molecular Formula | C23H33NS |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[(2S)-3,3-dimethylpent-4-en-2-yl]-5,5,8,8-tetramethyl-6,7-dihydrobenzo[f][1]benzothiol-3-amine |
| SMILES | C=CC(C)(C)[C@H](C)Nc1csc2cc3c(cc12)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C23H33NS/c1-9-21(3,4)15(2)24-19-14-25-20-13-18-17(12-16(19)20)22(5,6)10-11-23(18,7)8/h9,12-15,24H,1,10-11H2,2-8H3/t15-/m0/s1 |
| InChIKey | WDSWMZLHZXKCHC-HNNXBMFYSA-N |
| XLogP | 7.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|