C25H25NS — CID 170678790
4,4,7,7-tetramethyl-12-phenyl-17-thia-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene (PubChem CID 170678790) has the molecular formula C25H25NS and a molecular weight of 371.55 g/mol. Its IUPAC name is 4,4,7,7-tetramethyl-12-phenyl-17-thia-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene.
| Compound Name | 4,4,7,7-tetramethyl-12-phenyl-17-thia-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 170678790 |
| Molecular Formula | C25H25NS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4,4,7,7-tetramethyl-12-phenyl-17-thia-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)sc1ccnc(-c2ccccc2)c13 |
| InChI | InChI=1S/C25H25NS/c1-24(2)11-12-25(3,4)19-15-21-17(14-18(19)24)22-20(27-21)10-13-26-23(22)16-8-6-5-7-9-16/h5-10,13-15H,11-12H2,1-4H3 |
| InChIKey | PQSISYOUTDUWLR-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |