C20H19GeNS — CID 166018455
trimethyl-(1-phenyl-[1]benzothiolo[3,2-c]pyridin-6-yl)germane (PubChem CID 166018455) has the molecular formula C20H19GeNS and a molecular weight of 378.06 g/mol. Its IUPAC name is trimethyl-(1-phenyl-[1]benzothiolo[3,2-c]pyridin-6-yl)germane.
| Compound Name | trimethyl-(1-phenyl-[1]benzothiolo[3,2-c]pyridin-6-yl)germane |
|---|---|
| PubChem CID | 166018455 |
| Molecular Formula | C20H19GeNS |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | trimethyl-(1-phenyl-[1]benzothiolo[3,2-c]pyridin-6-yl)germane |
| SMILES | C[Ge](C)(C)c1cccc2c1sc1ccnc(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H19GeNS/c1-21(2,3)16-11-7-10-15-18-17(23-20(15)16)12-13-22-19(18)14-8-5-4-6-9-14/h4-13H,1-3H3 |
| InChIKey | ATEQKXDCKSUWNN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |