C13H9NS — CID 153314009
2-deuterio-4-phenylthieno[3,2-c]pyridine (PubChem CID 153314009) has the molecular formula C13H9NS and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-deuterio-4-phenylthieno[3,2-c]pyridine.
| Compound Name | 2-deuterio-4-phenylthieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 153314009 |
| Molecular Formula | C13H9NS |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-deuterio-4-phenylthieno[3,2-c]pyridine |
| SMILES | [2H]c1cc2c(-c3ccccc3)nccc2s1 |
| InChI | InChI=1S/C13H9NS/c1-2-4-10(5-3-1)13-11-7-9-15-12(11)6-8-14-13/h1-9H/i9D |
| InChIKey | UEXKIEYHNLJFQH-QOWOAITPSA-N |
| XLogP | 3.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |